C15H7Cl2NO5 — CID 151137388
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid (PubChem CID 151137388) has the molecular formula C15H7Cl2NO5 and a molecular weight of 352.13 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid |
|---|---|
| PubChem CID | 151137388 |
| Molecular Formula | C15H7Cl2NO5 |
| Molecular Weight | 352.13 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid |
| SMILES | O=C(O)c1c(O)cccc1N1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C15H7Cl2NO5/c16-8-4-6-7(5-9(8)17)14(21)18(13(6)20)10-2-1-3-11(19)12(10)15(22)23/h1-5,19H,(H,22,23) |
| InChIKey | MVMCURBMKSUJPE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.13 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|