2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid

C15H7Cl2NO5 — CID 151137388

IUPAC2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid
SMILESO=C(O)c1c(O)cccc1N1C(=O)c2cc(Cl)c(Cl)cc2C1=O
InChIInChI=1S/C15H7Cl2NO5/c16-8-4-6-7(5-9(8)17)14(21)18(13(6)20)10-2-1-3-11(19)12(10)15(22)23/h1-5,19H,(H,22,23)
InChIKeyMVMCURBMKSUJPE-UHFFFAOYSA-N
MW352.13 g/mol
LogP3.20
Rot. Bonds2

About 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid

2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid (PubChem CID 151137388) has the molecular formula C15H7Cl2NO5 and a molecular weight of 352.13 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid.

Molecular Properties

Compound Name2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid
PubChem CID151137388
Molecular FormulaC15H7Cl2NO5
Molecular Weight352.13 g/mol
Exact Mass350.97
IUPAC Name2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid
SMILESO=C(O)c1c(O)cccc1N1C(=O)c2cc(Cl)c(Cl)cc2C1=O
InChIInChI=1S/C15H7Cl2NO5/c16-8-4-6-7(5-9(8)17)14(21)18(13(6)20)10-2-1-3-11(19)12(10)15(22)23/h1-5,19H,(H,22,23)
InChIKeyMVMCURBMKSUJPE-UHFFFAOYSA-N
XLogP3.20
TPSA94.91 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.13
LogP ≤ 53.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid?
The IUPAC name of 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid (CID 151137388) is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid.
What is the SMILES notation for 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid?
The canonical SMILES for 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid is O=C(O)c1c(O)cccc1N1C(=O)c2cc(Cl)c(Cl)cc2C1=O.
What is the InChIKey of 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid?
The InChIKey is MVMCURBMKSUJPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7Cl2NO5/c16-8-4-6-7(5-9(8)17)14(21)18(13(6)20)10-2-1-3-11(19)12(10)15(22)23/h1-5,19H,(H,22,23).
What are the key properties of 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid?
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid has a molecular weight of 352.13 g/mol, XLogP of 3.20, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-6-hydroxybenzoic acid is sourced from PubChem (CID 151137388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).