C14H7Cl2NOS — CID 13163058
5,6-dichloro-2-phenyl-3-sulfanylideneisoindol-1-one (PubChem CID 13163058) has the molecular formula C14H7Cl2NOS and a molecular weight of 308.19 g/mol. Its IUPAC name is 5,6-dichloro-2-phenyl-3-sulfanylideneisoindol-1-one.
| Compound Name | 5,6-dichloro-2-phenyl-3-sulfanylideneisoindol-1-one |
|---|---|
| PubChem CID | 13163058 |
| Molecular Formula | C14H7Cl2NOS |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.96 |
| IUPAC Name | 5,6-dichloro-2-phenyl-3-sulfanylideneisoindol-1-one |
| SMILES | O=C1c2cc(Cl)c(Cl)cc2C(=S)N1c1ccccc1 |
| InChI | InChI=1S/C14H7Cl2NOS/c15-11-6-9-10(7-12(11)16)14(19)17(13(9)18)8-4-2-1-3-5-8/h1-7H |
| InChIKey | JSRGWSMUZYRQAZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|