C23H18Cl2N2O2 — CID 563253
5,6-dichloro-2-[(dibenzylamino)methyl]isoindole-1,3-dione (PubChem CID 563253) has the molecular formula C23H18Cl2N2O2 and a molecular weight of 425.32 g/mol. Its IUPAC name is 5,6-dichloro-2-[(dibenzylamino)methyl]isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-[(dibenzylamino)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 563253 |
| Molecular Formula | C23H18Cl2N2O2 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 5,6-dichloro-2-[(dibenzylamino)methyl]isoindole-1,3-dione |
| SMILES | O=C1c2cc(Cl)c(Cl)cc2C(=O)N1CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H18Cl2N2O2/c24-20-11-18-19(12-21(20)25)23(29)27(22(18)28)15-26(13-16-7-3-1-4-8-16)14-17-9-5-2-6-10-17/h1-12H,13-15H2 |
| InChIKey | BBSUDPUPVBDLME-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|