C17H15Cl2N2O2+ — CID 7911038
benzyl-[(5,6-dichloro-1,3-dioxoisoindol-2-yl)methyl]-methylazanium (PubChem CID 7911038) has the molecular formula C17H15Cl2N2O2+ and a molecular weight of 350.23 g/mol. Its IUPAC name is benzyl-[(5,6-dichloro-1,3-dioxoisoindol-2-yl)methyl]-methylazanium.
| Compound Name | benzyl-[(5,6-dichloro-1,3-dioxoisoindol-2-yl)methyl]-methylazanium |
|---|---|
| PubChem CID | 7911038 |
| Molecular Formula | C17H15Cl2N2O2+ |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | benzyl-[(5,6-dichloro-1,3-dioxoisoindol-2-yl)methyl]-methylazanium |
| SMILES | C[NH+](Cc1ccccc1)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C17H14Cl2N2O2/c1-20(9-11-5-3-2-4-6-11)10-21-16(22)12-7-14(18)15(19)8-13(12)17(21)23/h2-8H,9-10H2,1H3/p+1 |
| InChIKey | KHWQKNDBUCHDRQ-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|