C20H18Cl2N2O3 — CID 2708425
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide (PubChem CID 2708425) has the molecular formula C20H18Cl2N2O3 and a molecular weight of 405.28 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 2708425 |
| Molecular Formula | C20H18Cl2N2O3 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[(2S)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C20H18Cl2N2O3/c1-12(7-8-13-5-3-2-4-6-13)23-18(25)11-24-19(26)14-9-16(21)17(22)10-15(14)20(24)27/h2-6,9-10,12H,7-8,11H2,1H3,(H,23,25)/t12-/m0/s1 |
| InChIKey | KXISBEDTWZDPMK-LBPRGKRZSA-N |
| XLogP | 3.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|