C18H14Cl2N2O3 — CID 7404543
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(2-ethylphenyl)acetamide (PubChem CID 7404543) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(2-ethylphenyl)acetamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(2-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 7404543 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(2-ethylphenyl)acetamide |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-2-10-5-3-4-6-15(10)21-16(23)9-22-17(24)11-7-13(19)14(20)8-12(11)18(22)25/h3-8H,2,9H2,1H3,(H,21,23) |
| InChIKey | RZIHTYAVPYGCBA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|