C17H10Cl2F2N2O3S — CID 41405171
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[2-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 41405171) has the molecular formula C17H10Cl2F2N2O3S and a molecular weight of 431.25 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[2-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 41405171 |
| Molecular Formula | C17H10Cl2F2N2O3S |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C17H10Cl2F2N2O3S/c18-10-5-8-9(6-11(10)19)16(26)23(15(8)25)7-14(24)22-12-3-1-2-4-13(12)27-17(20)21/h1-6,17H,7H2,(H,22,24) |
| InChIKey | BGKWDNAIDNXLOW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|