C16H8BrCl3N2O3 — CID 51536649
N-(4-bromo-2-chlorophenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 51536649) has the molecular formula C16H8BrCl3N2O3 and a molecular weight of 462.51 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 51536649 |
| Molecular Formula | C16H8BrCl3N2O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 459.88 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H8BrCl3N2O3/c17-7-1-2-13(12(20)3-7)21-14(23)6-22-15(24)8-4-10(18)11(19)5-9(8)16(22)25/h1-5H,6H2,(H,21,23) |
| InChIKey | RDTXBWDCWZTXPB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|