C18H13BrCl2N2O3 — CID 112835557
N-(4-bromo-2,6-dimethylphenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide (PubChem CID 112835557) has the molecular formula C18H13BrCl2N2O3 and a molecular weight of 456.12 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 112835557 |
| Molecular Formula | C18H13BrCl2N2O3 |
| Molecular Weight | 456.12 g/mol |
| Exact Mass | 453.95 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)acetamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C18H13BrCl2N2O3/c1-8-3-10(19)4-9(2)16(8)22-15(24)7-23-17(25)11-5-13(20)14(21)6-12(11)18(23)26/h3-6H,7H2,1-2H3,(H,22,24) |
| InChIKey | PQTIRETXEIOXEK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.12 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|