C13H17BrClNO — CID 63681085
N-(4-bromo-2,6-dimethylphenyl)-3-chloro-2,2-dimethylpropanamide (PubChem CID 63681085) has the molecular formula C13H17BrClNO and a molecular weight of 318.64 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-3-chloro-2,2-dimethylpropanamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-3-chloro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 63681085 |
| Molecular Formula | C13H17BrClNO |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-3-chloro-2,2-dimethylpropanamide |
| SMILES | Cc1cc(Br)cc(C)c1NC(=O)C(C)(C)CCl |
| InChI | InChI=1S/C13H17BrClNO/c1-8-5-10(14)6-9(2)11(8)16-12(17)13(3,4)7-15/h5-6H,7H2,1-4H3,(H,16,17) |
| InChIKey | IEDCMAVIKWYDPG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|