C13H18BrNO2 — CID 103020703
N-(4-bromo-2,6-dimethylphenyl)-2-methoxy-2-methylpropanamide (PubChem CID 103020703) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-2-methoxy-2-methylpropanamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-2-methoxy-2-methylpropanamide |
|---|---|
| PubChem CID | 103020703 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-2-methoxy-2-methylpropanamide |
| SMILES | COC(C)(C)C(=O)Nc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C13H18BrNO2/c1-8-6-10(14)7-9(2)11(8)15-12(16)13(3,4)17-5/h6-7H,1-5H3,(H,15,16) |
| InChIKey | FNBUSYQFVVUZRO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |