C20H22BrCl2N3O2 — CID 71513973
N-[4-bromo-2-[[(2-chlorophenyl)methylamino]carbamoyl]-6-methylphenyl]-3-chloro-2,2-dimethylpropanamide (PubChem CID 71513973) has the molecular formula C20H22BrCl2N3O2 and a molecular weight of 487.23 g/mol. Its IUPAC name is N-[4-bromo-2-[[(2-chlorophenyl)methylamino]carbamoyl]-6-methylphenyl]-3-chloro-2,2-dimethylpropanamide.
| Compound Name | N-[4-bromo-2-[[(2-chlorophenyl)methylamino]carbamoyl]-6-methylphenyl]-3-chloro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 71513973 |
| Molecular Formula | C20H22BrCl2N3O2 |
| Molecular Weight | 487.23 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | N-[4-bromo-2-[[(2-chlorophenyl)methylamino]carbamoyl]-6-methylphenyl]-3-chloro-2,2-dimethylpropanamide |
| SMILES | Cc1cc(Br)cc(C(=O)NNCc2ccccc2Cl)c1NC(=O)C(C)(C)CCl |
| InChI | InChI=1S/C20H22BrCl2N3O2/c1-12-8-14(21)9-15(17(12)25-19(28)20(2,3)11-22)18(27)26-24-10-13-6-4-5-7-16(13)23/h4-9,24H,10-11H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | CXJXWXKRLFVCRH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.23 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|