C21H24Cl3N3O2 — CID 71513516
N-[4-chloro-2-[[(2,4-dichlorophenyl)methylamino]carbamoyl]-6-methylphenyl]-3,3-dimethylbutanamide (PubChem CID 71513516) has the molecular formula C21H24Cl3N3O2 and a molecular weight of 456.80 g/mol. Its IUPAC name is N-[4-chloro-2-[[(2,4-dichlorophenyl)methylamino]carbamoyl]-6-methylphenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[4-chloro-2-[[(2,4-dichlorophenyl)methylamino]carbamoyl]-6-methylphenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 71513516 |
| Molecular Formula | C21H24Cl3N3O2 |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | N-[4-chloro-2-[[(2,4-dichlorophenyl)methylamino]carbamoyl]-6-methylphenyl]-3,3-dimethylbutanamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NNCc2ccc(Cl)cc2Cl)c1NC(=O)CC(C)(C)C |
| InChI | InChI=1S/C21H24Cl3N3O2/c1-12-7-15(23)8-16(19(12)26-18(28)10-21(2,3)4)20(29)27-25-11-13-5-6-14(22)9-17(13)24/h5-9,25H,10-11H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | ALGVAPRAVKGJRC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|