C21H22Cl2F3N3O2 — CID 71513735
3-chloro-N-[4-chloro-2-methyl-6-[[[3-(trifluoromethyl)phenyl]methylamino]carbamoyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 71513735) has the molecular formula C21H22Cl2F3N3O2 and a molecular weight of 476.33 g/mol. Its IUPAC name is 3-chloro-N-[4-chloro-2-methyl-6-[[[3-(trifluoromethyl)phenyl]methylamino]carbamoyl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[4-chloro-2-methyl-6-[[[3-(trifluoromethyl)phenyl]methylamino]carbamoyl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 71513735 |
| Molecular Formula | C21H22Cl2F3N3O2 |
| Molecular Weight | 476.33 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 3-chloro-N-[4-chloro-2-methyl-6-[[[3-(trifluoromethyl)phenyl]methylamino]carbamoyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | Cc1cc(Cl)cc(C(=O)NNCc2cccc(C(F)(F)F)c2)c1NC(=O)C(C)(C)CCl |
| InChI | InChI=1S/C21H22Cl2F3N3O2/c1-12-7-15(23)9-16(17(12)28-19(31)20(2,3)11-22)18(30)29-27-10-13-5-4-6-14(8-13)21(24,25)26/h4-9,27H,10-11H2,1-3H3,(H,28,31)(H,29,30) |
| InChIKey | GQHCLAFUCHOPCH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.33 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|