C19H19ClF3NOS — CID 10150798
3-chloro-2,2-dimethyl-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]propanamide (PubChem CID 10150798) has the molecular formula C19H19ClF3NOS and a molecular weight of 401.88 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]propanamide |
|---|---|
| PubChem CID | 10150798 |
| Molecular Formula | C19H19ClF3NOS |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-[2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]phenyl]propanamide |
| SMILES | CC(C)(CCl)C(=O)Nc1ccccc1SCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19ClF3NOS/c1-18(2,12-20)17(25)24-15-8-3-4-9-16(15)26-11-13-6-5-7-14(10-13)19(21,22)23/h3-10H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | NHDKXNRTJJNODL-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|