C16H10F6O2S — CID 88838454
3-(trifluoromethyl)-4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]benzoic acid (PubChem CID 88838454) has the molecular formula C16H10F6O2S and a molecular weight of 380.31 g/mol. Its IUPAC name is 3-(trifluoromethyl)-4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]benzoic acid.
| Compound Name | 3-(trifluoromethyl)-4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 88838454 |
| Molecular Formula | C16H10F6O2S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 3-(trifluoromethyl)-4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]benzoic acid |
| SMILES | O=C(O)c1ccc(SCc2cccc(C(F)(F)F)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F6O2S/c17-15(18,19)11-3-1-2-9(6-11)8-25-13-5-4-10(14(23)24)7-12(13)16(20,21)22/h1-7H,8H2,(H,23,24) |
| InChIKey | NBHBPUPOCXLHJF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |