C13H9F3O2S2 — CID 79139166
4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]thiophene-2-carboxylic acid (PubChem CID 79139166) has the molecular formula C13H9F3O2S2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 79139166 |
| Molecular Formula | C13H9F3O2S2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(SCc2cccc(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C13H9F3O2S2/c14-13(15,16)9-3-1-2-8(4-9)6-19-10-5-11(12(17)18)20-7-10/h1-5,7H,6H2,(H,17,18) |
| InChIKey | SMQBPMKNCMXGHJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |