C18H13F3O3S — CID 54706493
3-hydroxy-2-phenyl-4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-2H-furan-5-one (PubChem CID 54706493) has the molecular formula C18H13F3O3S and a molecular weight of 366.36 g/mol. Its IUPAC name is 3-hydroxy-2-phenyl-4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-2H-furan-5-one.
| Compound Name | 3-hydroxy-2-phenyl-4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 54706493 |
| Molecular Formula | C18H13F3O3S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 3-hydroxy-2-phenyl-4-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-2H-furan-5-one |
| SMILES | O=C1OC(c2ccccc2)C(O)=C1SCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F3O3S/c19-18(20,21)13-8-4-5-11(9-13)10-25-16-14(22)15(24-17(16)23)12-6-2-1-3-7-12/h1-9,15,22H,10H2 |
| InChIKey | RLLVPKWGKYQVBO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |