C23H17F3N2OS — CID 2392049
3-(2-methylphenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one (PubChem CID 2392049) has the molecular formula C23H17F3N2OS and a molecular weight of 426.46 g/mol. Its IUPAC name is 3-(2-methylphenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(2-methylphenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 2392049 |
| Molecular Formula | C23H17F3N2OS |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 3-(2-methylphenyl)-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one |
| SMILES | Cc1ccccc1-n1c(SCc2cccc(C(F)(F)F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H17F3N2OS/c1-15-7-2-5-12-20(15)28-21(29)18-10-3-4-11-19(18)27-22(28)30-14-16-8-6-9-17(13-16)23(24,25)26/h2-13H,14H2,1H3 |
| InChIKey | VLMRSZABFRXJBF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |