C25H21F3N2OS2 — CID 4848338
3-(3,4-dimethylphenyl)-2-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]quinazolin-4-one (PubChem CID 4848338) has the molecular formula C25H21F3N2OS2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-2-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(3,4-dimethylphenyl)-2-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4848338 |
| Molecular Formula | C25H21F3N2OS2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-2-[2-[3-(trifluoromethyl)phenyl]sulfanylethylsulfanyl]quinazolin-4-one |
| SMILES | Cc1ccc(-n2c(SCCSc3cccc(C(F)(F)F)c3)nc3ccccc3c2=O)cc1C |
| InChI | InChI=1S/C25H21F3N2OS2/c1-16-10-11-19(14-17(16)2)30-23(31)21-8-3-4-9-22(21)29-24(30)33-13-12-32-20-7-5-6-18(15-20)25(26,27)28/h3-11,14-15H,12-13H2,1-2H3 |
| InChIKey | GATDFWXARSDZNH-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|