C23H16F4N2OS — CID 3609799
3-[(4-fluorophenyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one (PubChem CID 3609799) has the molecular formula C23H16F4N2OS and a molecular weight of 444.45 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-[(4-fluorophenyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 3609799 |
| Molecular Formula | C23H16F4N2OS |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(SCc2cccc(C(F)(F)F)c2)n1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C23H16F4N2OS/c24-18-10-8-15(9-11-18)13-29-21(30)19-6-1-2-7-20(19)28-22(29)31-14-16-4-3-5-17(12-16)23(25,26)27/h1-12H,13-14H2 |
| InChIKey | ZSPRAZKCGOGCBK-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |