C16H11F4N3OS — CID 53366632
3-amino-7-fluoro-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one (PubChem CID 53366632) has the molecular formula C16H11F4N3OS and a molecular weight of 369.34 g/mol. Its IUPAC name is 3-amino-7-fluoro-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-amino-7-fluoro-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 53366632 |
| Molecular Formula | C16H11F4N3OS |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 3-amino-7-fluoro-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]quinazolin-4-one |
| SMILES | Nn1c(SCc2cccc(C(F)(F)F)c2)nc2cc(F)ccc2c1=O |
| InChI | InChI=1S/C16H11F4N3OS/c17-11-4-5-12-13(7-11)22-15(23(21)14(12)24)25-8-9-2-1-3-10(6-9)16(18,19)20/h1-7H,8,21H2 |
| InChIKey | MIKJNTWQLHLTIA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |