C16H13ClFN3O2S — CID 53490308
3-amino-7-chloro-2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]quinazolin-4-one (PubChem CID 53490308) has the molecular formula C16H13ClFN3O2S and a molecular weight of 365.82 g/mol. Its IUPAC name is 3-amino-7-chloro-2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-amino-7-chloro-2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 53490308 |
| Molecular Formula | C16H13ClFN3O2S |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 3-amino-7-chloro-2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]quinazolin-4-one |
| SMILES | COc1ccc(CSc2nc3cc(Cl)ccc3c(=O)n2N)cc1F |
| InChI | InChI=1S/C16H13ClFN3O2S/c1-23-14-5-2-9(6-12(14)18)8-24-16-20-13-7-10(17)3-4-11(13)15(22)21(16)19/h2-7H,8,19H2,1H3 |
| InChIKey | FYJRCUSFOMJKLO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |