C19H16ClFN2O2S — CID 4819889
6-chloro-2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one (PubChem CID 4819889) has the molecular formula C19H16ClFN2O2S and a molecular weight of 390.87 g/mol. Its IUPAC name is 6-chloro-2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one.
| Compound Name | 6-chloro-2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 4819889 |
| Molecular Formula | C19H16ClFN2O2S |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 6-chloro-2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCc2ccc(OC)c(F)c2)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C19H16ClFN2O2S/c1-3-8-23-18(24)14-10-13(20)5-6-16(14)22-19(23)26-11-12-4-7-17(25-2)15(21)9-12/h3-7,9-10H,1,8,11H2,2H3 |
| InChIKey | LFTDDONDILSISM-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|