C21H17ClN4O2S — CID 43075255
2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-6-chloro-3-prop-2-enylquinazolin-4-one (PubChem CID 43075255) has the molecular formula C21H17ClN4O2S and a molecular weight of 424.91 g/mol. Its IUPAC name is 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-6-chloro-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-6-chloro-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 43075255 |
| Molecular Formula | C21H17ClN4O2S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-[(3-benzyl-1,2,4-oxadiazol-5-yl)methylsulfanyl]-6-chloro-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCc2nc(Cc3ccccc3)no2)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C21H17ClN4O2S/c1-2-10-26-20(27)16-12-15(22)8-9-17(16)23-21(26)29-13-19-24-18(25-28-19)11-14-6-4-3-5-7-14/h2-9,12H,1,10-11,13H2 |
| InChIKey | IMLNPBUBGGDJTD-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|