C21H17ClN4O2S — CID 39522079
7-chloro-2-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one (PubChem CID 39522079) has the molecular formula C21H17ClN4O2S and a molecular weight of 424.91 g/mol. Its IUPAC name is 7-chloro-2-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one.
| Compound Name | 7-chloro-2-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 39522079 |
| Molecular Formula | C21H17ClN4O2S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 7-chloro-2-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCc2nc(-c3cccc(C)c3)no2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C21H17ClN4O2S/c1-3-9-26-20(27)16-8-7-15(22)11-17(16)23-21(26)29-12-18-24-19(25-28-18)14-6-4-5-13(2)10-14/h3-8,10-11H,1,9,12H2,2H3 |
| InChIKey | TXSFDZVJPUWBHX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|