C20H15ClN4O2S — CID 36562784
2-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one (PubChem CID 36562784) has the molecular formula C20H15ClN4O2S and a molecular weight of 410.89 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 36562784 |
| Molecular Formula | C20H15ClN4O2S |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCc2noc(-c3ccc(Cl)cc3)n2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H15ClN4O2S/c1-2-11-25-19(26)15-5-3-4-6-16(15)22-20(25)28-12-17-23-18(27-24-17)13-7-9-14(21)10-8-13/h2-10H,1,11-12H2 |
| InChIKey | HZGXOSDOLHPLGV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|