C20H16ClN5OS — CID 75398757
7-chloro-2-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one (PubChem CID 75398757) has the molecular formula C20H16ClN5OS and a molecular weight of 409.90 g/mol. Its IUPAC name is 7-chloro-2-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one.
| Compound Name | 7-chloro-2-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 75398757 |
| Molecular Formula | C20H16ClN5OS |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 7-chloro-2-[(1-phenyl-1,2,4-triazol-3-yl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCc2ncn(-c3ccccc3)n2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H16ClN5OS/c1-2-10-25-19(27)16-9-8-14(21)11-17(16)23-20(25)28-12-18-22-13-26(24-18)15-6-4-3-5-7-15/h2-9,11,13H,1,10,12H2 |
| InChIKey | ZNLGMGXYNOTWGP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|