C19H14ClN3OS2 — CID 16504673
2-(1,3-benzothiazol-2-ylmethylsulfanyl)-7-chloro-3-prop-2-enylquinazolin-4-one (PubChem CID 16504673) has the molecular formula C19H14ClN3OS2 and a molecular weight of 399.93 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-7-chloro-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-7-chloro-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 16504673 |
| Molecular Formula | C19H14ClN3OS2 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylmethylsulfanyl)-7-chloro-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCc2nc3ccccc3s2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H14ClN3OS2/c1-2-9-23-18(24)13-8-7-12(20)10-15(13)22-19(23)25-11-17-21-14-5-3-4-6-16(14)26-17/h2-8,10H,1,9,11H2 |
| InChIKey | YADANIFZPNJNNP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|