C19H16Cl2N2O3S2 — CID 37113833
7-chloro-2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]-3-prop-2-enylquinazolin-4-one (PubChem CID 37113833) has the molecular formula C19H16Cl2N2O3S2 and a molecular weight of 455.39 g/mol. Its IUPAC name is 7-chloro-2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]-3-prop-2-enylquinazolin-4-one.
| Compound Name | 7-chloro-2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 37113833 |
| Molecular Formula | C19H16Cl2N2O3S2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | 7-chloro-2-[2-(4-chlorophenyl)sulfonylethylsulfanyl]-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCCS(=O)(=O)c2ccc(Cl)cc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H16Cl2N2O3S2/c1-2-9-23-18(24)16-8-5-14(21)12-17(16)22-19(23)27-10-11-28(25,26)15-6-3-13(20)4-7-15/h2-8,12H,1,9-11H2 |
| InChIKey | JMRHUGWUZPBDIA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|