C22H16ClN5O2S — CID 4787349
2-[2-[(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylmethyl]-4-oxoquinazolin-3-yl]acetonitrile (PubChem CID 4787349) has the molecular formula C22H16ClN5O2S and a molecular weight of 449.92 g/mol. Its IUPAC name is 2-[2-[(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylmethyl]-4-oxoquinazolin-3-yl]acetonitrile.
| Compound Name | 2-[2-[(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylmethyl]-4-oxoquinazolin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 4787349 |
| Molecular Formula | C22H16ClN5O2S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 2-[2-[(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylmethyl]-4-oxoquinazolin-3-yl]acetonitrile |
| SMILES | C=CCn1c(SCc2nc3ccccc3c(=O)n2CC#N)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C22H16ClN5O2S/c1-2-10-28-21(30)16-8-7-14(23)12-18(16)26-22(28)31-13-19-25-17-6-4-3-5-15(17)20(29)27(19)11-9-24/h2-8,12H,1,10-11,13H2 |
| InChIKey | OTLXYTOKRQVZNG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 93.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|