C20H14Cl2N4O2S — CID 55373867
7-chloro-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one (PubChem CID 55373867) has the molecular formula C20H14Cl2N4O2S and a molecular weight of 445.33 g/mol. Its IUPAC name is 7-chloro-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one.
| Compound Name | 7-chloro-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 55373867 |
| Molecular Formula | C20H14Cl2N4O2S |
| Molecular Weight | 445.33 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | 7-chloro-2-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCc2nc(-c3ccc(Cl)cc3)no2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H14Cl2N4O2S/c1-2-9-26-19(27)15-8-7-14(22)10-16(15)23-20(26)29-11-17-24-18(25-28-17)12-3-5-13(21)6-4-12/h2-8,10H,1,9,11H2 |
| InChIKey | JJTIDWBSSGXFRH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.33 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|