C16H15ClN4O2S — CID 7691747
2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-cyanoethyl)acetamide (PubChem CID 7691747) has the molecular formula C16H15ClN4O2S and a molecular weight of 362.84 g/mol. Its IUPAC name is 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 7691747 |
| Molecular Formula | C16H15ClN4O2S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-cyanoethyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NCCC#N)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C16H15ClN4O2S/c1-2-8-21-15(23)12-9-11(17)4-5-13(12)20-16(21)24-10-14(22)19-7-3-6-18/h2,4-5,9H,1,3,7-8,10H2,(H,19,22) |
| InChIKey | KMXTTWLBNWABGI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|