C19H18ClN3O2S2 — CID 55384383
2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 55384383) has the molecular formula C19H18ClN3O2S2 and a molecular weight of 419.96 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 55384383 |
| Molecular Formula | C19H18ClN3O2S2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NCCc2cccs2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H18ClN3O2S2/c1-2-9-23-18(25)15-6-5-13(20)11-16(15)22-19(23)27-12-17(24)21-8-7-14-4-3-10-26-14/h2-6,10-11H,1,7-9,12H2,(H,21,24) |
| InChIKey | IIFOSGLHCCTLDO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|