C22H21ClN4O3S — CID 24674358
N-(benzylcarbamoyl)-3-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide (PubChem CID 24674358) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is N-(benzylcarbamoyl)-3-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide.
| Compound Name | N-(benzylcarbamoyl)-3-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 24674358 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | N-(benzylcarbamoyl)-3-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(SCCC(=O)NC(=O)NCc2ccccc2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C22H21ClN4O3S/c1-2-11-27-20(29)17-9-8-16(23)13-18(17)25-22(27)31-12-10-19(28)26-21(30)24-14-15-6-4-3-5-7-15/h2-9,13H,1,10-12,14H2,(H2,24,26,28,30) |
| InChIKey | JUUBRVQDOWDATO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|