C14H14N4S2 — CID 78765201
2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-benzothiazole (PubChem CID 78765201) has the molecular formula C14H14N4S2 and a molecular weight of 302.43 g/mol. Its IUPAC name is 2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-benzothiazole.
| Compound Name | 2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 78765201 |
| Molecular Formula | C14H14N4S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-benzothiazole |
| SMILES | C=CCn1c(C)nnc1SCc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H14N4S2/c1-3-8-18-10(2)16-17-14(18)19-9-13-15-11-6-4-5-7-12(11)20-13/h3-7H,1,8-9H2,2H3 |
| InChIKey | RKDSARIKLDKVQL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|