C16H16N4S2 — CID 2451950
4-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-phenyl-1,3-thiazole (PubChem CID 2451950) has the molecular formula C16H16N4S2 and a molecular weight of 328.47 g/mol. Its IUPAC name is 4-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-phenyl-1,3-thiazole.
| Compound Name | 4-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 2451950 |
| Molecular Formula | C16H16N4S2 |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 4-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-2-phenyl-1,3-thiazole |
| SMILES | C=CCn1c(C)nnc1SCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H16N4S2/c1-3-9-20-12(2)18-19-16(20)22-11-14-10-21-15(17-14)13-7-5-4-6-8-13/h3-8,10H,1,9,11H2,2H3 |
| InChIKey | RDIIBHBJTOTKOT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|