C21H17ClN4S2 — CID 19728046
2-(2-chlorophenyl)-4-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazole (PubChem CID 19728046) has the molecular formula C21H17ClN4S2 and a molecular weight of 424.98 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazole.
| Compound Name | 2-(2-chlorophenyl)-4-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 19728046 |
| Molecular Formula | C21H17ClN4S2 |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 2-(2-chlorophenyl)-4-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-thiazole |
| SMILES | C=CCn1c(SCc2csc(-c3ccccc3Cl)n2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C21H17ClN4S2/c1-2-12-26-19(15-8-4-3-5-9-15)24-25-21(26)28-14-16-13-27-20(23-16)17-10-6-7-11-18(17)22/h2-11,13H,1,12,14H2 |
| InChIKey | LDPZKEREUIXDGH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|