C15H11N5S2 — CID 2345708
2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-benzothiazole (PubChem CID 2345708) has the molecular formula C15H11N5S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-benzothiazole.
| Compound Name | 2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 2345708 |
| Molecular Formula | C15H11N5S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]-1,3-benzothiazole |
| SMILES | c1ccc(-n2nnnc2SCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C15H11N5S2/c1-2-6-11(7-3-1)20-15(17-18-19-20)21-10-14-16-12-8-4-5-9-13(12)22-14/h1-9H,10H2 |
| InChIKey | VHIORQXFUZNSTO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |