C17H15N5S3 — CID 2328314
2-[3-(1-phenyltetrazol-5-yl)sulfanylpropylsulfanyl]-1,3-benzothiazole (PubChem CID 2328314) has the molecular formula C17H15N5S3 and a molecular weight of 385.54 g/mol. Its IUPAC name is 2-[3-(1-phenyltetrazol-5-yl)sulfanylpropylsulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[3-(1-phenyltetrazol-5-yl)sulfanylpropylsulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 2328314 |
| Molecular Formula | C17H15N5S3 |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-[3-(1-phenyltetrazol-5-yl)sulfanylpropylsulfanyl]-1,3-benzothiazole |
| SMILES | c1ccc(-n2nnnc2SCCCSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H15N5S3/c1-2-7-13(8-3-1)22-16(19-20-21-22)23-11-6-12-24-17-18-14-9-4-5-10-15(14)25-17/h1-5,7-10H,6,11-12H2 |
| InChIKey | RREBBBMVYHNOHX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|