C9H7N5S2 — CID 18707851
2-(1-methyltetrazol-5-yl)sulfanyl-1,3-benzothiazole (PubChem CID 18707851) has the molecular formula C9H7N5S2 and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-1,3-benzothiazole.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 18707851 |
| Molecular Formula | C9H7N5S2 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1,3-benzothiazole |
| SMILES | Cn1nnnc1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H7N5S2/c1-14-8(11-12-13-14)16-9-10-6-4-2-3-5-7(6)15-9/h2-5H,1H3 |
| InChIKey | IELNQZGBMRVAKO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |