C10H7N5O2S2 — CID 25250348
2-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)sulfanyl]-1,3-benzothiazole (PubChem CID 25250348) has the molecular formula C10H7N5O2S2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)sulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)sulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 25250348 |
| Molecular Formula | C10H7N5O2S2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 2-[(2-methyl-5-nitro-1,2,4-triazol-3-yl)sulfanyl]-1,3-benzothiazole |
| SMILES | Cn1nc([N+](=O)[O-])nc1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C10H7N5O2S2/c1-14-9(12-8(13-14)15(16)17)19-10-11-6-4-2-3-5-7(6)18-10/h2-5H,1H3 |
| InChIKey | SFTBSMJPTXDTCJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|