C13H9N3O2S2 — CID 13458466
5-(1,3-benzothiazol-2-ylsulfanyl)-2-nitroaniline (PubChem CID 13458466) has the molecular formula C13H9N3O2S2 and a molecular weight of 303.37 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-ylsulfanyl)-2-nitroaniline.
| Compound Name | 5-(1,3-benzothiazol-2-ylsulfanyl)-2-nitroaniline |
|---|---|
| PubChem CID | 13458466 |
| Molecular Formula | C13H9N3O2S2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 5-(1,3-benzothiazol-2-ylsulfanyl)-2-nitroaniline |
| SMILES | Nc1cc(Sc2nc3ccccc3s2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9N3O2S2/c14-9-7-8(5-6-11(9)16(17)18)19-13-15-10-3-1-2-4-12(10)20-13/h1-7H,14H2 |
| InChIKey | UQPCCTIXPCBBAH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|