C10H7N3S3 — CID 90885082
4-(1,3-benzothiazol-2-ylsulfanyl)-1,3-thiazol-2-amine (PubChem CID 90885082) has the molecular formula C10H7N3S3 and a molecular weight of 265.39 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 90885082 |
| Molecular Formula | C10H7N3S3 |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(Sc2nc3ccccc3s2)cs1 |
| InChI | InChI=1S/C10H7N3S3/c11-9-13-8(5-14-9)16-10-12-6-3-1-2-4-7(6)15-10/h1-5H,(H2,11,13) |
| InChIKey | MFHAJOKRVJBWBQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |