C12H9N3S2 — CID 78843311
2-(6-methylpyrimidin-4-yl)sulfanyl-1,3-benzothiazole (PubChem CID 78843311) has the molecular formula C12H9N3S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2-(6-methylpyrimidin-4-yl)sulfanyl-1,3-benzothiazole.
| Compound Name | 2-(6-methylpyrimidin-4-yl)sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 78843311 |
| Molecular Formula | C12H9N3S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-(6-methylpyrimidin-4-yl)sulfanyl-1,3-benzothiazole |
| SMILES | Cc1cc(Sc2nc3ccccc3s2)ncn1 |
| InChI | InChI=1S/C12H9N3S2/c1-8-6-11(14-7-13-8)17-12-15-9-4-2-3-5-10(9)16-12/h2-7H,1H3 |
| InChIKey | WNBNEPPTTHRYGY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |