C16H11N3OS2 — CID 110435768
2-(7-methoxyquinazolin-4-yl)sulfanyl-1,3-benzothiazole (PubChem CID 110435768) has the molecular formula C16H11N3OS2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-(7-methoxyquinazolin-4-yl)sulfanyl-1,3-benzothiazole.
| Compound Name | 2-(7-methoxyquinazolin-4-yl)sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 110435768 |
| Molecular Formula | C16H11N3OS2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-(7-methoxyquinazolin-4-yl)sulfanyl-1,3-benzothiazole |
| SMILES | COc1ccc2c(Sc3nc4ccccc4s3)ncnc2c1 |
| InChI | InChI=1S/C16H11N3OS2/c1-20-10-6-7-11-13(8-10)17-9-18-15(11)22-16-19-12-4-2-3-5-14(12)21-16/h2-9H,1H3 |
| InChIKey | OCPFCMYHMVYRQN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |