C25H20N2O5S3 — CID 58565683
N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 58565683) has the molecular formula C25H20N2O5S3 and a molecular weight of 524.65 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 58565683 |
| Molecular Formula | C25H20N2O5S3 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Nc2cc(Sc3nc4ccccc4s3)c(O)c3ccccc23)c1 |
| InChI | InChI=1S/C25H20N2O5S3/c1-31-15-11-12-20(32-2)23(13-15)35(29,30)27-19-14-22(24(28)17-8-4-3-7-16(17)19)34-25-26-18-9-5-6-10-21(18)33-25/h3-14,27-28H,1-2H3 |
| InChIKey | ZWLNAOXWQLQPDF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|