C26H17N3O3S3 — CID 58565777
N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]quinoline-8-sulfonamide (PubChem CID 58565777) has the molecular formula C26H17N3O3S3 and a molecular weight of 515.64 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]quinoline-8-sulfonamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 58565777 |
| Molecular Formula | C26H17N3O3S3 |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-ylsulfanyl)-4-hydroxynaphthalen-1-yl]quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Sc2nc3ccccc3s2)c(O)c2ccccc12)c1cccc2cccnc12 |
| InChI | InChI=1S/C26H17N3O3S3/c30-25-18-10-2-1-9-17(18)20(15-22(25)34-26-28-19-11-3-4-12-21(19)33-26)29-35(31,32)23-13-5-7-16-8-6-14-27-24(16)23/h1-15,29-30H |
| InChIKey | KBRNBDJNFIBRMN-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|