C28H19N3O3S2 — CID 58565702
N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)quinoline-8-sulfonamide (PubChem CID 58565702) has the molecular formula C28H19N3O3S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)quinoline-8-sulfonamide.
| Compound Name | N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 58565702 |
| Molecular Formula | C28H19N3O3S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)quinoline-8-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Sc2cccc3cccnc23)c(O)c2ccccc12)c1cccc2cccnc12 |
| InChI | InChI=1S/C28H19N3O3S2/c32-28-21-12-2-1-11-20(21)22(17-24(28)35-23-13-3-7-18-9-5-15-29-26(18)23)31-36(33,34)25-14-4-8-19-10-6-16-30-27(19)25/h1-17,31-32H |
| InChIKey | OWUAJXOTVUXAMJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|