C26H20N2O3S2 — CID 90278720
N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)-3-methylbenzenesulfonamide (PubChem CID 90278720) has the molecular formula C26H20N2O3S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)-3-methylbenzenesulfonamide.
| Compound Name | N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 90278720 |
| Molecular Formula | C26H20N2O3S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)Nc2cc(Sc3cccc4cccnc34)c(O)c3ccccc23)c1 |
| InChI | InChI=1S/C26H20N2O3S2/c1-17-7-4-10-19(15-17)33(30,31)28-22-16-24(26(29)21-12-3-2-11-20(21)22)32-23-13-5-8-18-9-6-14-27-25(18)23/h2-16,28-29H,1H3 |
| InChIKey | TVPCRSIFNRFTKK-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|